C27H28N4O5 — CID 126273567
N'-[(Z)-[3-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-ethylphenyl)oxamide (PubChem CID 126273567) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is N'-[(Z)-[3-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-ethylphenyl)oxamide.
| Compound Name | N'-[(Z)-[3-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-ethylphenyl)oxamide |
|---|---|
| PubChem CID | 126273567 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | N'-[(Z)-[3-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-ethylphenyl)oxamide |
| SMILES | CCOc1ccc(NC(=O)COc2cccc(/C=N\NC(=O)C(=O)Nc3ccccc3CC)c2)cc1 |
| InChI | InChI=1S/C27H28N4O5/c1-3-20-9-5-6-11-24(20)30-26(33)27(34)31-28-17-19-8-7-10-23(16-19)36-18-25(32)29-21-12-14-22(15-13-21)35-4-2/h5-17H,3-4,18H2,1-2H3,(H,29,32)(H,30,33)(H,31,34)/b28-17- |
| InChIKey | ULDJEOHHVVVKSS-QRQIAZFYSA-N |
| XLogP | 3.75 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|