C27H21ClF3N3O3 — CID 126274532
(E)-3-[5-chloro-2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126274532) has the molecular formula C27H21ClF3N3O3 and a molecular weight of 527.93 g/mol. Its IUPAC name is (E)-3-[5-chloro-2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-chloro-2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126274532 |
| Molecular Formula | C27H21ClF3N3O3 |
| Molecular Weight | 527.93 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | (E)-3-[5-chloro-2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(C)c(NC(=O)COc2ccc(Cl)cc2/C=C(\C#N)C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C27H21ClF3N3O3/c1-16-6-7-17(2)23(10-16)34-25(35)15-37-24-9-8-21(28)12-18(24)11-19(14-32)26(36)33-22-5-3-4-20(13-22)27(29,30)31/h3-13H,15H2,1-2H3,(H,33,36)(H,34,35)/b19-11+ |
| InChIKey | SMBYRNPKTOJNRD-YBFXNURJSA-N |
| XLogP | 6.54 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.93 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|