C26H28N4O2S2 — CID 126278829
2-[[2-[(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)sulfanyl]acetyl]amino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126278829) has the molecular formula C26H28N4O2S2 and a molecular weight of 492.67 g/mol. Its IUPAC name is 2-[[2-[(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)sulfanyl]acetyl]amino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)sulfanyl]acetyl]amino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126278829 |
| Molecular Formula | C26H28N4O2S2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 2-[[2-[(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)sulfanyl]acetyl]amino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1nc(SCC(=O)Nc2sc3c(c2C(=O)Nc2ccccc2)CCCC3)nc2c1CCCC2 |
| InChI | InChI=1S/C26H28N4O2S2/c1-16-18-11-5-7-13-20(18)29-26(27-16)33-15-22(31)30-25-23(19-12-6-8-14-21(19)34-25)24(32)28-17-9-3-2-4-10-17/h2-4,9-10H,5-8,11-15H2,1H3,(H,28,32)(H,30,31) |
| InChIKey | NZQKUPUZHZNWTG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |