C26H25N5O3S2 — CID 126390582
2-[[2-[[5-(phenoxymethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126390582) has the molecular formula C26H25N5O3S2 and a molecular weight of 519.65 g/mol. Its IUPAC name is 2-[[2-[[5-(phenoxymethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-(phenoxymethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126390582 |
| Molecular Formula | C26H25N5O3S2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 2-[[2-[[5-(phenoxymethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(CSc1n[nH]c(COc2ccccc2)n1)Nc1sc2c(c1C(=O)Nc1ccccc1)CCCC2 |
| InChI | InChI=1S/C26H25N5O3S2/c32-22(16-35-26-28-21(30-31-26)15-34-18-11-5-2-6-12-18)29-25-23(19-13-7-8-14-20(19)36-25)24(33)27-17-9-3-1-4-10-17/h1-6,9-12H,7-8,13-16H2,(H,27,33)(H,29,32)(H,28,30,31) |
| InChIKey | QCYGDLYLWNBHBS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |