C20H21N5O2S2 — CID 2447795
2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(4-methylbenzoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide (PubChem CID 2447795) has the molecular formula C20H21N5O2S2 and a molecular weight of 427.56 g/mol. Its IUPAC name is 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(4-methylbenzoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide.
| Compound Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(4-methylbenzoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide |
|---|---|
| PubChem CID | 2447795 |
| Molecular Formula | C20H21N5O2S2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[3-(4-methylbenzoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide |
| SMILES | Cc1ccc(C(=O)c2c(NC(=O)CSc3n[nH]c(N)n3)sc3c2CCCC3)cc1 |
| InChI | InChI=1S/C20H21N5O2S2/c1-11-6-8-12(9-7-11)17(27)16-13-4-2-3-5-14(13)29-18(16)22-15(26)10-28-20-23-19(21)24-25-20/h6-9H,2-5,10H2,1H3,(H,22,26)(H3,21,23,24,25) |
| InChIKey | SCIHPUVWKKEFOU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |