C22H23FN4O4S2 — CID 126390554
ethyl 2-[[2-[[5-[(2-fluorophenoxy)methyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 126390554) has the molecular formula C22H23FN4O4S2 and a molecular weight of 490.58 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[(2-fluorophenoxy)methyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-[(2-fluorophenoxy)methyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 126390554 |
| Molecular Formula | C22H23FN4O4S2 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | ethyl 2-[[2-[[5-[(2-fluorophenoxy)methyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2n[nH]c(COc3ccccc3F)n2)sc2c1CCCC2 |
| InChI | InChI=1S/C22H23FN4O4S2/c1-2-30-21(29)19-13-7-3-6-10-16(13)33-20(19)25-18(28)12-32-22-24-17(26-27-22)11-31-15-9-5-4-8-14(15)23/h4-5,8-9H,2-3,6-7,10-12H2,1H3,(H,25,28)(H,24,26,27) |
| InChIKey | PNRFVWUUEQHXMM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |