C16H21N5O2S2 — CID 29345154
2-[[2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 29345154) has the molecular formula C16H21N5O2S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is 2-[[2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 29345154 |
| Molecular Formula | C16H21N5O2S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-[[2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)c1nc(SCC(=O)Nc2sc3c(c2C(N)=O)CCCC3)n[nH]1 |
| InChI | InChI=1S/C16H21N5O2S2/c1-8(2)14-19-16(21-20-14)24-7-11(22)18-15-12(13(17)23)9-5-3-4-6-10(9)25-15/h8H,3-7H2,1-2H3,(H2,17,23)(H,18,22)(H,19,20,21) |
| InChIKey | NKODCUPCAVQZQE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |