C32H34N4O3 — CID 126282046
3-[[4-(dimethylamino)-2-prop-2-ynoxyphenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126282046) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)-2-prop-2-ynoxyphenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[4-(dimethylamino)-2-prop-2-ynoxyphenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126282046 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 3-[[4-(dimethylamino)-2-prop-2-ynoxyphenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | C#CCOc1cc(N(C)C)ccc1C=Nn1c(-c2cc(C(C)C)c(OCC)cc2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C32H34N4O3/c1-8-16-39-29-18-24(35(6)7)15-14-23(29)20-33-36-31(34-28-13-11-10-12-25(28)32(36)37)27-19-26(21(3)4)30(38-9-2)17-22(27)5/h1,10-15,17-21H,9,16H2,2-7H3 |
| InChIKey | MNGVTXPXKCTLQU-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 68.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|