C28H30N4O3 — CID 137125738
3-[[4-(dimethylamino)-2-hydroxyphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 137125738) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)-2-hydroxyphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[4-(dimethylamino)-2-hydroxyphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 137125738 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 3-[[4-(dimethylamino)-2-hydroxyphenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | COc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2ccc(N(C)C)cc2O)cc1C(C)C |
| InChI | InChI=1S/C28H30N4O3/c1-17(2)22-15-23(18(3)13-26(22)35-6)27-30-24-10-8-7-9-21(24)28(34)32(27)29-16-19-11-12-20(31(4)5)14-25(19)33/h7-17,33H,1-6H3 |
| InChIKey | AAZJDHOAIMEYMA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|