C33H27N3O3S — CID 126282862
N-(2,3-dimethylphenyl)-2-[(5Z)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126282862) has the molecular formula C33H27N3O3S and a molecular weight of 545.66 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[(5Z)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[(5Z)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126282862 |
| Molecular Formula | C33H27N3O3S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[(5Z)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)S/C(=C\c3cn(Cc4ccc5ccccc5c4)c4ccccc34)C2=O)c1C |
| InChI | InChI=1S/C33H27N3O3S/c1-21-8-7-12-28(22(21)2)34-31(37)20-36-32(38)30(40-33(36)39)17-26-19-35(29-13-6-5-11-27(26)29)18-23-14-15-24-9-3-4-10-25(24)16-23/h3-17,19H,18,20H2,1-2H3,(H,34,37)/b30-17- |
| InChIKey | VHBZXMOOMKFZHX-LQNQUEJISA-N |
| XLogP | 7.13 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|