C34H30FN5O6 — CID 126283239
N-(3-fluorophenyl)-2-[4-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]acetamide (PubChem CID 126283239) has the molecular formula C34H30FN5O6 and a molecular weight of 623.64 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[4-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[4-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]acetamide |
|---|---|
| PubChem CID | 126283239 |
| Molecular Formula | C34H30FN5O6 |
| Molecular Weight | 623.64 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | N-(3-fluorophenyl)-2-[4-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]acetamide |
| SMILES | COc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2ccc(OCC(=O)Nc3cccc(F)c3)c([N+](=O)[O-])c2)cc1C(C)C |
| InChI | InChI=1S/C34H30FN5O6/c1-20(2)26-17-27(21(3)14-31(26)45-4)33-38-28-11-6-5-10-25(28)34(42)39(33)36-18-22-12-13-30(29(15-22)40(43)44)46-19-32(41)37-24-9-7-8-23(35)16-24/h5-18,20H,19H2,1-4H3,(H,37,41) |
| InChIKey | BBZWLQNTQNIYNO-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|