C29H24BrN3O4 — CID 126284670
6-bromo-3-[[3,5-dimethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126284670) has the molecular formula C29H24BrN3O4 and a molecular weight of 558.43 g/mol. Its IUPAC name is 6-bromo-3-[[3,5-dimethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[3,5-dimethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126284670 |
| Molecular Formula | C29H24BrN3O4 |
| Molecular Weight | 558.43 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | 6-bromo-3-[[3,5-dimethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)cc(OC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H24BrN3O4/c1-18-32-25-12-11-22(30)15-24(25)29(34)33(18)31-16-19-13-26(35-2)28(27(14-19)36-3)37-17-21-9-6-8-20-7-4-5-10-23(20)21/h4-16H,17H2,1-3H3 |
| InChIKey | FGCZCCIHDPHFSQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.43 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|