C13H9N3O2 — CID 12628639
3-phenyl-1H-pyrido[3,2-d]pyrimidine-2,4-dione (PubChem CID 12628639) has the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. Its IUPAC name is 3-phenyl-1H-pyrido[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-phenyl-1H-pyrido[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 12628639 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-phenyl-1H-pyrido[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2cccnc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C13H9N3O2/c17-12-11-10(7-4-8-14-11)15-13(18)16(12)9-5-2-1-3-6-9/h1-8H,(H,15,18) |
| InChIKey | WSRVJAYJTCPSBG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |