C30H26ClN3O6 — CID 126290144
propan-2-yl 2-[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenoxy]acetate (PubChem CID 126290144) has the molecular formula C30H26ClN3O6 and a molecular weight of 560.01 g/mol. Its IUPAC name is propan-2-yl 2-[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenoxy]acetate.
| Compound Name | propan-2-yl 2-[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126290144 |
| Molecular Formula | C30H26ClN3O6 |
| Molecular Weight | 560.01 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | propan-2-yl 2-[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)ccc1OCC(=O)OC(C)C |
| InChI | InChI=1S/C30H26ClN3O6/c1-4-37-26-13-19(9-11-25(26)38-17-28(35)39-18(2)3)16-32-34-29(33-23-8-6-5-7-22(23)30(34)36)27-15-20-14-21(31)10-12-24(20)40-27/h5-16,18H,4,17H2,1-3H3 |
| InChIKey | SOSBHNBHWYLFSU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 105.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.01 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|