C24H25BrN4O6 — CID 126293302
ethyl (2R)-2-[2-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]propanoate (PubChem CID 126293302) has the molecular formula C24H25BrN4O6 and a molecular weight of 545.39 g/mol. Its IUPAC name is ethyl (2R)-2-[2-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[2-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 126293302 |
| Molecular Formula | C24H25BrN4O6 |
| Molecular Weight | 545.39 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | ethyl (2R)-2-[2-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1c(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H25BrN4O6/c1-6-34-22(31)14(2)35-20-15(8-7-9-19(20)29(32)33)13-26-28-21(30)17-12-16(25)10-11-18(17)27-23(28)24(3,4)5/h7-14H,6H2,1-5H3/t14-/m1/s1 |
| InChIKey | YUMSNBNFAPYZEZ-CQSZACIVSA-N |
| XLogP | 4.58 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|