C19H15BrN4O6 — CID 126297125
(2S)-2-[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]propanoic acid (PubChem CID 126297125) has the molecular formula C19H15BrN4O6 and a molecular weight of 475.26 g/mol. Its IUPAC name is (2S)-2-[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]propanoic acid.
| Compound Name | (2S)-2-[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]propanoic acid |
|---|---|
| PubChem CID | 126297125 |
| Molecular Formula | C19H15BrN4O6 |
| Molecular Weight | 475.26 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | (2S)-2-[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]propanoic acid |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1N=Cc1cccc([N+](=O)[O-])c1O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C19H15BrN4O6/c1-10(19(26)27)30-17-12(4-3-5-16(17)24(28)29)9-21-23-11(2)22-15-7-6-13(20)8-14(15)18(23)25/h3-10H,1-2H3,(H,26,27)/t10-/m0/s1 |
| InChIKey | BIRLTKHCVSEJFT-JTQLQIEISA-N |
| XLogP | 3.11 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|