C22H23BrN4O4 — CID 126329255
6-bromo-2-[(2S)-butan-2-yl]-3-[(3-nitro-2-propan-2-yloxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126329255) has the molecular formula C22H23BrN4O4 and a molecular weight of 487.35 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[(3-nitro-2-propan-2-yloxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(3-nitro-2-propan-2-yloxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126329255 |
| Molecular Formula | C22H23BrN4O4 |
| Molecular Weight | 487.35 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(3-nitro-2-propan-2-yloxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cccc([N+](=O)[O-])c1OC(C)C |
| InChI | InChI=1S/C22H23BrN4O4/c1-5-14(4)21-25-18-10-9-16(23)11-17(18)22(28)26(21)24-12-15-7-6-8-19(27(29)30)20(15)31-13(2)3/h6-14H,5H2,1-4H3/t14-/m0/s1 |
| InChIKey | NGIMRLNGRBRMEW-AWEZNQCLSA-N |
| XLogP | 5.25 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.35 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|