C28H24BrN3O4 — CID 126294081
2-(1-benzofuran-2-yl)-3-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-methoxyphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126294081) has the molecular formula C28H24BrN3O4 and a molecular weight of 546.42 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-methoxyphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-methoxyphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126294081 |
| Molecular Formula | C28H24BrN3O4 |
| Molecular Weight | 546.42 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-methoxyphenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)Oc1c(Br)cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C28H24BrN3O4/c1-4-17(2)35-26-21(29)13-18(14-24(26)34-3)16-30-32-27(25-15-19-9-5-8-12-23(19)36-25)31-22-11-7-6-10-20(22)28(32)33/h5-17H,4H2,1-3H3/t17-/m0/s1 |
| InChIKey | ATYJFOJDQVAKEG-KRWDZBQOSA-N |
| XLogP | 6.64 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.42 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|