C29H17Cl2F3N4O4 — CID 126295275
3-[[4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126295275) has the molecular formula C29H17Cl2F3N4O4 and a molecular weight of 613.38 g/mol. Its IUPAC name is 3-[[4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126295275 |
| Molecular Formula | C29H17Cl2F3N4O4 |
| Molecular Weight | 613.38 g/mol |
| Exact Mass | 612.06 |
| IUPAC Name | 3-[[4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cccc(C(F)(F)F)c2)n1N=Cc1ccc(OCc2ccc(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H17Cl2F3N4O4/c30-21-10-9-19(23(31)14-21)16-42-26-11-8-17(12-25(26)38(40)41)15-35-37-27(18-4-3-5-20(13-18)29(32,33)34)36-24-7-2-1-6-22(24)28(37)39/h1-15H,16H2 |
| InChIKey | DZIFYHAOVOCRCA-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.38 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|