C20H19NO5 — CID 12629574
dimethyl 2-benzoyl-3,4-dihydro-1H-isoquinoline-7,8-dicarboxylate (PubChem CID 12629574) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is dimethyl 2-benzoyl-3,4-dihydro-1H-isoquinoline-7,8-dicarboxylate.
| Compound Name | dimethyl 2-benzoyl-3,4-dihydro-1H-isoquinoline-7,8-dicarboxylate |
|---|---|
| PubChem CID | 12629574 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | dimethyl 2-benzoyl-3,4-dihydro-1H-isoquinoline-7,8-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1C(=O)OC)CN(C(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C20H19NO5/c1-25-19(23)15-9-8-13-10-11-21(12-16(13)17(15)20(24)26-2)18(22)14-6-4-3-5-7-14/h3-9H,10-12H2,1-2H3 |
| InChIKey | ARPAIEJEKXCHQV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |