C22H19N3O3 — CID 126301285
(3aS,4R,7R,7aR)-7-methyl-2-[4-[(4-methylphenyl)diazenyl]phenyl]-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione (PubChem CID 126301285) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is (3aS,4R,7R,7aR)-7-methyl-2-[4-[(4-methylphenyl)diazenyl]phenyl]-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4R,7R,7aR)-7-methyl-2-[4-[(4-methylphenyl)diazenyl]phenyl]-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 126301285 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (3aS,4R,7R,7aR)-7-methyl-2-[4-[(4-methylphenyl)diazenyl]phenyl]-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
| SMILES | Cc1ccc(/N=N/c2ccc(N3C(=O)[C@H]4[C@@H](C3=O)[C@@]3(C)C=C[C@H]4O3)cc2)cc1 |
| InChI | InChI=1S/C22H19N3O3/c1-13-3-5-14(6-4-13)23-24-15-7-9-16(10-8-15)25-20(26)18-17-11-12-22(2,28-17)19(18)21(25)27/h3-12,17-19H,1-2H3/b24-23+/t17-,18-,19+,22-/m1/s1 |
| InChIKey | CTDVVEFVYRYJGV-SMWBXKMMSA-N |
| XLogP | 4.24 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|