C15H12BrNO3 — CID 2189413
(3aR,4S,7R,7aS)-2-(4-bromophenyl)-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione (PubChem CID 2189413) has the molecular formula C15H12BrNO3 and a molecular weight of 334.17 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-2-(4-bromophenyl)-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7R,7aS)-2-(4-bromophenyl)-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 2189413 |
| Molecular Formula | C15H12BrNO3 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | (3aR,4S,7R,7aS)-2-(4-bromophenyl)-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
| SMILES | C[C@]12C=C[C@H](O1)[C@@H]1C(=O)N(c3ccc(Br)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C15H12BrNO3/c1-15-7-6-10(20-15)11-12(15)14(19)17(13(11)18)9-4-2-8(16)3-5-9/h2-7,10-12H,1H3/t10-,11-,12+,15+/m0/s1 |
| InChIKey | MMFCGDGZKRGDII-UUIJZJDISA-N |
| XLogP | 2.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|