C31H19ClFN5O6 — CID 126304123
2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-nitrophenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 126304123) has the molecular formula C31H19ClFN5O6 and a molecular weight of 611.97 g/mol. Its IUPAC name is 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-nitrophenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-nitrophenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126304123 |
| Molecular Formula | C31H19ClFN5O6 |
| Molecular Weight | 611.97 g/mol |
| Exact Mass | 611.10 |
| IUPAC Name | 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-nitrophenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(COc1c(Cl)cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc1[N+](=O)[O-])Nc1ccccc1F |
| InChI | InChI=1S/C31H19ClFN5O6/c32-21-13-18(14-25(38(41)42)29(21)43-17-28(39)35-24-11-5-3-9-22(24)33)16-34-37-30(27-15-19-7-1-6-12-26(19)44-27)36-23-10-4-2-8-20(23)31(37)40/h1-16H,17H2,(H,35,39) |
| InChIKey | LVTPXALRICJUTP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 141.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.97 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|