C31H20FIN4O4 — CID 126304830
2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-iodophenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 126304830) has the molecular formula C31H20FIN4O4 and a molecular weight of 658.43 g/mol. Its IUPAC name is 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-iodophenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-iodophenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126304830 |
| Molecular Formula | C31H20FIN4O4 |
| Molecular Weight | 658.43 g/mol |
| Exact Mass | 658.05 |
| IUPAC Name | 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-iodophenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc1I)Nc1ccccc1F |
| InChI | InChI=1S/C31H20FIN4O4/c32-22-9-3-5-11-25(22)35-29(38)18-40-27-14-13-19(15-23(27)33)17-34-37-30(28-16-20-7-1-6-12-26(20)41-28)36-24-10-4-2-8-21(24)31(37)39/h1-17H,18H2,(H,35,38) |
| InChIKey | NSIAAJPPKGKNPT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.43 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|