C30H30BrN3O4 — CID 126308298
3-[(5-benzoyl-2,4-diethoxyphenyl)methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one (PubChem CID 126308298) has the molecular formula C30H30BrN3O4 and a molecular weight of 576.49 g/mol. Its IUPAC name is 3-[(5-benzoyl-2,4-diethoxyphenyl)methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one.
| Compound Name | 3-[(5-benzoyl-2,4-diethoxyphenyl)methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one |
|---|---|
| PubChem CID | 126308298 |
| Molecular Formula | C30H30BrN3O4 |
| Molecular Weight | 576.49 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | 3-[(5-benzoyl-2,4-diethoxyphenyl)methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one |
| SMILES | CCOc1cc(OCC)c(C(=O)c2ccccc2)cc1C=Nn1c(C(C)(C)C)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C30H30BrN3O4/c1-6-37-25-17-26(38-7-2)23(27(35)19-11-9-8-10-12-19)15-20(25)18-32-34-28(36)22-16-21(31)13-14-24(22)33-29(34)30(3,4)5/h8-18H,6-7H2,1-5H3 |
| InChIKey | DFCNNLLZSMCHPK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.49 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|