C30H29BrClN3O3 — CID 126308323
6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126308323) has the molecular formula C30H29BrClN3O3 and a molecular weight of 594.94 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126308323 |
| Molecular Formula | C30H29BrClN3O3 |
| Molecular Weight | 594.94 g/mol |
| Exact Mass | 593.11 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c([C@@H](C)CC)nc3ccc(Br)cc3c2=O)cc(OC)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H29BrClN3O3/c1-5-7-22-14-21(15-27(37-4)28(22)38-18-20-8-11-24(32)12-9-20)17-33-35-29(19(3)6-2)34-26-13-10-23(31)16-25(26)30(35)36/h5,8-17,19H,1,6-7,18H2,2-4H3/t19-/m0/s1 |
| InChIKey | HTZKPSPMWHMNLJ-IBGZPJMESA-N |
| XLogP | 7.52 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.94 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|