C27H17F3N4O4 — CID 126310951
3-[[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126310951) has the molecular formula C27H17F3N4O4 and a molecular weight of 518.45 g/mol. Its IUPAC name is 3-[[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126310951 |
| Molecular Formula | C27H17F3N4O4 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 3-[[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | Cc1ccc(-c2ccc(C=Nn3c(-c4cccc(C(F)(F)F)c4)nc4ccccc4c3=O)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H17F3N4O4/c1-16-9-10-17(14-23(16)34(36)37)24-12-11-20(38-24)15-31-33-25(18-5-4-6-19(13-18)27(28,29)30)32-22-8-3-2-7-21(22)26(33)35/h2-15H,1H3 |
| InChIKey | LCYZGGJNMYLVFA-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 103.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|