C27H29BrN4O3 — CID 126313304
ethyl (2R)-2-[3-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]propanoate (PubChem CID 126313304) has the molecular formula C27H29BrN4O3 and a molecular weight of 537.46 g/mol. Its IUPAC name is ethyl (2R)-2-[3-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]propanoate.
| Compound Name | ethyl (2R)-2-[3-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]propanoate |
|---|---|
| PubChem CID | 126313304 |
| Molecular Formula | C27H29BrN4O3 |
| Molecular Weight | 537.46 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | ethyl (2R)-2-[3-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)n1c(C)c(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C27H29BrN4O3/c1-7-35-25(34)17(3)31-16(2)21(19-10-8-9-11-23(19)31)15-29-32-24(33)20-14-18(28)12-13-22(20)30-26(32)27(4,5)6/h8-15,17H,7H2,1-6H3/t17-/m1/s1 |
| InChIKey | TVMIUUIHZGSRRH-QGZVFWFLSA-N |
| XLogP | 5.73 |
| TPSA | 78.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|