C31H29Br2FN4O4 — CID 126314266
2-[2,3-dibromo-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-ethoxyphenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 126314266) has the molecular formula C31H29Br2FN4O4 and a molecular weight of 700.40 g/mol. Its IUPAC name is 2-[2,3-dibromo-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-ethoxyphenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[2,3-dibromo-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-ethoxyphenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126314266 |
| Molecular Formula | C31H29Br2FN4O4 |
| Molecular Weight | 700.40 g/mol |
| Exact Mass | 698.05 |
| IUPAC Name | 2-[2,3-dibromo-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-ethoxyphenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | CCOc1cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)c(Br)c(Br)c1OCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C31H29Br2FN4O4/c1-2-41-25-16-20(27(32)28(33)29(25)42-18-26(39)36-24-15-9-7-13-22(24)34)17-35-38-30(19-10-4-3-5-11-19)37-23-14-8-6-12-21(23)31(38)40/h6-9,12-17,19H,2-5,10-11,18H2,1H3,(H,36,39) |
| InChIKey | XHRARBVXUWEZFN-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.40 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|