C23H20BrN5O — CID 126314886
2-[3-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]acetonitrile (PubChem CID 126314886) has the molecular formula C23H20BrN5O and a molecular weight of 462.35 g/mol. Its IUPAC name is 2-[3-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]acetonitrile.
| Compound Name | 2-[3-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 126314886 |
| Molecular Formula | C23H20BrN5O |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 2-[3-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]acetonitrile |
| SMILES | Cc1c(C=Nn2c(C(C)C)nc3ccc(Br)cc3c2=O)c2ccccc2n1CC#N |
| InChI | InChI=1S/C23H20BrN5O/c1-14(2)22-27-20-9-8-16(24)12-18(20)23(30)29(22)26-13-19-15(3)28(11-10-25)21-7-5-4-6-17(19)21/h4-9,12-14H,11H2,1-3H3 |
| InChIKey | YHICCPRYQPXEGQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 75.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|