C24H23BrN4O3 — CID 126295526
ethyl 2-[3-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]acetate (PubChem CID 126295526) has the molecular formula C24H23BrN4O3 and a molecular weight of 495.38 g/mol. Its IUPAC name is ethyl 2-[3-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 126295526 |
| Molecular Formula | C24H23BrN4O3 |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | ethyl 2-[3-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c(C=Nn2c(CC)nc3ccc(Br)cc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C24H23BrN4O3/c1-4-22-27-20-11-10-16(25)12-18(20)24(31)29(22)26-13-19-15(3)28(14-23(30)32-5-2)21-9-7-6-8-17(19)21/h6-13H,4-5,14H2,1-3H3 |
| InChIKey | MFMDTGXQNVUEJX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|