C22H24BrN3O4 — CID 126320146
6-bromo-2-[(2R)-butan-2-yl]-3-[(2,4,5-trimethoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126320146) has the molecular formula C22H24BrN3O4 and a molecular weight of 474.36 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[(2,4,5-trimethoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[(2,4,5-trimethoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126320146 |
| Molecular Formula | C22H24BrN3O4 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[(2,4,5-trimethoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C22H24BrN3O4/c1-6-13(2)21-25-17-8-7-15(23)10-16(17)22(27)26(21)24-12-14-9-19(29-4)20(30-5)11-18(14)28-3/h7-13H,6H2,1-5H3/t13-/m1/s1 |
| InChIKey | RHUQCFAOPUYCAV-CYBMUJFWSA-N |
| XLogP | 4.58 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|