C21H20BrN3O4 — CID 126329707
6-bromo-2-[(2S)-butan-2-yl]-3-[(6-methoxy-1,3-benzodioxol-5-yl)methylideneamino]quinazolin-4-one (PubChem CID 126329707) has the molecular formula C21H20BrN3O4 and a molecular weight of 458.31 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[(6-methoxy-1,3-benzodioxol-5-yl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(6-methoxy-1,3-benzodioxol-5-yl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126329707 |
| Molecular Formula | C21H20BrN3O4 |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(6-methoxy-1,3-benzodioxol-5-yl)methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc2c(cc1OC)OCO2 |
| InChI | InChI=1S/C21H20BrN3O4/c1-4-12(2)20-24-16-6-5-14(22)8-15(16)21(26)25(20)23-10-13-7-18-19(29-11-28-18)9-17(13)27-3/h5-10,12H,4,11H2,1-3H3/t12-/m0/s1 |
| InChIKey | OIHNNQSVGGLSMQ-LBPRGKRZSA-N |
| XLogP | 4.29 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|