C13H28OSi — CID 12632626
4-tert-butyl-1-trimethylsilylcyclohexan-1-ol (PubChem CID 12632626) has the molecular formula C13H28OSi and a molecular weight of 228.45 g/mol. Its IUPAC name is 4-tert-butyl-1-trimethylsilylcyclohexan-1-ol.
| Compound Name | 4-tert-butyl-1-trimethylsilylcyclohexan-1-ol |
|---|---|
| PubChem CID | 12632626 |
| Molecular Formula | C13H28OSi |
| Molecular Weight | 228.45 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 4-tert-butyl-1-trimethylsilylcyclohexan-1-ol |
| SMILES | CC(C)(C)C1CCC(O)([Si](C)(C)C)CC1 |
| InChI | InChI=1S/C13H28OSi/c1-12(2,3)11-7-9-13(14,10-8-11)15(4,5)6/h11,14H,7-10H2,1-6H3 |
| InChIKey | JMDNRAYHZPHGKM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|