C19H19N3O5 — CID 1263266
N-(2-cyano-4,5-diethoxyphenyl)-3-methyl-4-nitrobenzamide (PubChem CID 1263266) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is N-(2-cyano-4,5-diethoxyphenyl)-3-methyl-4-nitrobenzamide.
| Compound Name | N-(2-cyano-4,5-diethoxyphenyl)-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 1263266 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-(2-cyano-4,5-diethoxyphenyl)-3-methyl-4-nitrobenzamide |
| SMILES | CCOc1cc(C#N)c(NC(=O)c2ccc([N+](=O)[O-])c(C)c2)cc1OCC |
| InChI | InChI=1S/C19H19N3O5/c1-4-26-17-9-14(11-20)15(10-18(17)27-5-2)21-19(23)13-6-7-16(22(24)25)12(3)8-13/h6-10H,4-5H2,1-3H3,(H,21,23) |
| InChIKey | IDCKPNYLJNNUMA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|