C24H22N2O6 — CID 126329068
2-[3-[(E)-[(3-methoxy-4-phenylmethoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 126329068) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is 2-[3-[(E)-[(3-methoxy-4-phenylmethoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(E)-[(3-methoxy-4-phenylmethoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126329068 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-[3-[(E)-[(3-methoxy-4-phenylmethoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1cc(C(=O)N/N=C/c2cccc(OCC(=O)O)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H22N2O6/c1-30-22-13-19(10-11-21(22)32-15-17-6-3-2-4-7-17)24(29)26-25-14-18-8-5-9-20(12-18)31-16-23(27)28/h2-14H,15-16H2,1H3,(H,26,29)(H,27,28)/b25-14+ |
| InChIKey | LUPHCKWLGNJVDV-AFUMVMLFSA-N |
| XLogP | 3.50 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|