C26H24N2O4 — CID 126326615
3-ethoxy-4-phenylmethoxy-N-[(E)-(3-prop-2-ynoxyphenyl)methylideneamino]benzamide (PubChem CID 126326615) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 3-ethoxy-4-phenylmethoxy-N-[(E)-(3-prop-2-ynoxyphenyl)methylideneamino]benzamide.
| Compound Name | 3-ethoxy-4-phenylmethoxy-N-[(E)-(3-prop-2-ynoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126326615 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 3-ethoxy-4-phenylmethoxy-N-[(E)-(3-prop-2-ynoxyphenyl)methylideneamino]benzamide |
| SMILES | C#CCOc1cccc(/C=N/NC(=O)c2ccc(OCc3ccccc3)c(OCC)c2)c1 |
| InChI | InChI=1S/C26H24N2O4/c1-3-15-31-23-12-8-11-21(16-23)18-27-28-26(29)22-13-14-24(25(17-22)30-4-2)32-19-20-9-6-5-7-10-20/h1,5-14,16-18H,4,15,19H2,2H3,(H,28,29)/b27-18+ |
| InChIKey | BDJTZDIYXBEEIT-OVVQPSECSA-N |
| XLogP | 4.44 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|