C20H22BrNO5S2 — CID 126333041
methyl 2-[5-bromo-4-[(Z)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetate (PubChem CID 126333041) has the molecular formula C20H22BrNO5S2 and a molecular weight of 500.44 g/mol. Its IUPAC name is methyl 2-[5-bromo-4-[(Z)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[5-bromo-4-[(Z)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126333041 |
| Molecular Formula | C20H22BrNO5S2 |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 499.01 |
| IUPAC Name | methyl 2-[5-bromo-4-[(Z)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1cc(Br)c(/C=C2\SC(=S)N(C3CCCCC3)C2=O)cc1OC |
| InChI | InChI=1S/C20H22BrNO5S2/c1-25-15-8-12(14(21)10-16(15)27-11-18(23)26-2)9-17-19(24)22(20(28)29-17)13-6-4-3-5-7-13/h8-10,13H,3-7,11H2,1-2H3/b17-9- |
| InChIKey | GCLOEXVLVNUCLL-MFOYZWKCSA-N |
| XLogP | 4.54 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|