C20H19BrN2O5S2 — CID 126208311
methyl 2-[5-bromo-4-[(E)-[3-(2,5-dimethylpyrrol-1-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 126208311) has the molecular formula C20H19BrN2O5S2 and a molecular weight of 511.42 g/mol. Its IUPAC name is methyl 2-[5-bromo-4-[(E)-[3-(2,5-dimethylpyrrol-1-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[5-bromo-4-[(E)-[3-(2,5-dimethylpyrrol-1-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126208311 |
| Molecular Formula | C20H19BrN2O5S2 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 509.99 |
| IUPAC Name | methyl 2-[5-bromo-4-[(E)-[3-(2,5-dimethylpyrrol-1-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1cc(Br)c(/C=C2/SC(=S)N(n3c(C)ccc3C)C2=O)cc1OC |
| InChI | InChI=1S/C20H19BrN2O5S2/c1-11-5-6-12(2)22(11)23-19(25)17(30-20(23)29)8-13-7-15(26-3)16(9-14(13)21)28-10-18(24)27-4/h5-9H,10H2,1-4H3/b17-8+ |
| InChIKey | ZJWAIKLJUWBPPI-CAOOACKPSA-N |
| XLogP | 3.97 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|