C19H14Br2ClNO2S2 — CID 126335397
(5Z)-3-(4-bromo-3-chlorophenyl)-5-[(3-bromo-4-propan-2-yloxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126335397) has the molecular formula C19H14Br2ClNO2S2 and a molecular weight of 547.72 g/mol. Its IUPAC name is (5Z)-3-(4-bromo-3-chlorophenyl)-5-[(3-bromo-4-propan-2-yloxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(4-bromo-3-chlorophenyl)-5-[(3-bromo-4-propan-2-yloxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126335397 |
| Molecular Formula | C19H14Br2ClNO2S2 |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 544.85 |
| IUPAC Name | (5Z)-3-(4-bromo-3-chlorophenyl)-5-[(3-bromo-4-propan-2-yloxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)Oc1ccc(/C=C2\SC(=S)N(c3ccc(Br)c(Cl)c3)C2=O)cc1Br |
| InChI | InChI=1S/C19H14Br2ClNO2S2/c1-10(2)25-16-6-3-11(7-14(16)21)8-17-18(24)23(19(26)27-17)12-4-5-13(20)15(22)9-12/h3-10H,1-2H3/b17-8- |
| InChIKey | CVNVDQKUXOMFID-IUXPMGMMSA-N |
| XLogP | 7.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|