C20H16BrClN2OS2 — CID 126351461
(5E)-3-(4-bromo-3-chlorophenyl)-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126351461) has the molecular formula C20H16BrClN2OS2 and a molecular weight of 479.85 g/mol. Its IUPAC name is (5E)-3-(4-bromo-3-chlorophenyl)-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(4-bromo-3-chlorophenyl)-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126351461 |
| Molecular Formula | C20H16BrClN2OS2 |
| Molecular Weight | 479.85 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | (5E)-3-(4-bromo-3-chlorophenyl)-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(N3CCCC3)cc2)SC(=S)N1c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C20H16BrClN2OS2/c21-16-8-7-15(12-17(16)22)24-19(25)18(27-20(24)26)11-13-3-5-14(6-4-13)23-9-1-2-10-23/h3-8,11-12H,1-2,9-10H2/b18-11+ |
| InChIKey | JAQDAQKSJGOMIQ-WOJGMQOQSA-N |
| XLogP | 6.11 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.85 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|