C14H8BrClN2OS2 — CID 126348519
(5E)-3-(4-bromo-3-chlorophenyl)-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126348519) has the molecular formula C14H8BrClN2OS2 and a molecular weight of 399.72 g/mol. Its IUPAC name is (5E)-3-(4-bromo-3-chlorophenyl)-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(4-bromo-3-chlorophenyl)-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126348519 |
| Molecular Formula | C14H8BrClN2OS2 |
| Molecular Weight | 399.72 g/mol |
| Exact Mass | 397.89 |
| IUPAC Name | (5E)-3-(4-bromo-3-chlorophenyl)-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc[nH]2)SC(=S)N1c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C14H8BrClN2OS2/c15-10-4-3-9(7-11(10)16)18-13(19)12(21-14(18)20)6-8-2-1-5-17-8/h1-7,17H/b12-6+ |
| InChIKey | FICZFLWIMLKGTB-WUXMJOGZSA-N |
| XLogP | 4.84 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.72 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|