C24H17BrFNO2S2 — CID 126338377
(5E)-5-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126338377) has the molecular formula C24H17BrFNO2S2 and a molecular weight of 514.44 g/mol. Its IUPAC name is (5E)-5-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126338377 |
| Molecular Formula | C24H17BrFNO2S2 |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 512.99 |
| IUPAC Name | (5E)-5-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)/C(=C\c3cc(Br)ccc3OCc3ccccc3F)SC2=S)cc1 |
| InChI | InChI=1S/C24H17BrFNO2S2/c1-15-6-9-19(10-7-15)27-23(28)22(31-24(27)30)13-17-12-18(25)8-11-21(17)29-14-16-4-2-3-5-20(16)26/h2-13H,14H2,1H3/b22-13+ |
| InChIKey | PWNISTNQCVHVJC-LPYMAVHISA-N |
| XLogP | 6.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|