C25H20BrNO2S2 — CID 126353560
(5E)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-3-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126353560) has the molecular formula C25H20BrNO2S2 and a molecular weight of 510.48 g/mol. Its IUPAC name is (5E)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-3-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-3-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126353560 |
| Molecular Formula | C25H20BrNO2S2 |
| Molecular Weight | 510.48 g/mol |
| Exact Mass | 509.01 |
| IUPAC Name | (5E)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-3-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)/C(=C\c3cc(Br)ccc3OCc3ccccc3)SC2=S)c(C)c1 |
| InChI | InChI=1S/C25H20BrNO2S2/c1-16-8-10-21(17(2)12-16)27-24(28)23(31-25(27)30)14-19-13-20(26)9-11-22(19)29-15-18-6-4-3-5-7-18/h3-14H,15H2,1-2H3/b23-14+ |
| InChIKey | QWIIXHCRCRFAOB-OEAKJJBVSA-N |
| XLogP | 7.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.48 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|