C25H19ClFNO2S2 — CID 50871393
(5E)-5-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-3-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 50871393) has the molecular formula C25H19ClFNO2S2 and a molecular weight of 484.02 g/mol. Its IUPAC name is (5E)-5-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-3-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-3-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50871393 |
| Molecular Formula | C25H19ClFNO2S2 |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | (5E)-5-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]-3-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)/C(=C\c3ccccc3OCc3c(F)cccc3Cl)SC2=S)c(C)c1 |
| InChI | InChI=1S/C25H19ClFNO2S2/c1-15-10-11-21(16(2)12-15)28-24(29)23(32-25(28)31)13-17-6-3-4-9-22(17)30-14-18-19(26)7-5-8-20(18)27/h3-13H,14H2,1-2H3/b23-13+ |
| InChIKey | CDQLUHCPOJRQQV-YDZHTSKRSA-N |
| XLogP | 7.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|