C20H14BrNO6S2 — CID 126338521
methyl 2-[4-[(E)-[3-(1,3-benzodioxol-5-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-bromophenoxy]acetate (PubChem CID 126338521) has the molecular formula C20H14BrNO6S2 and a molecular weight of 508.37 g/mol. Its IUPAC name is methyl 2-[4-[(E)-[3-(1,3-benzodioxol-5-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-bromophenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-[3-(1,3-benzodioxol-5-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-bromophenoxy]acetate |
|---|---|
| PubChem CID | 126338521 |
| Molecular Formula | C20H14BrNO6S2 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 506.94 |
| IUPAC Name | methyl 2-[4-[(E)-[3-(1,3-benzodioxol-5-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-bromophenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=C2/SC(=S)N(c3ccc4c(c3)OCO4)C2=O)cc1Br |
| InChI | InChI=1S/C20H14BrNO6S2/c1-25-18(23)9-26-14-4-2-11(6-13(14)21)7-17-19(24)22(20(29)30-17)12-3-5-15-16(8-12)28-10-27-15/h2-8H,9-10H2,1H3/b17-7+ |
| InChIKey | QWGSYMPIZCRHAE-REZTVBANSA-N |
| XLogP | 4.14 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|