C20H15F2NO5S2 — CID 126358139
(5Z)-3-(1,3-benzodioxol-5-yl)-5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126358139) has the molecular formula C20H15F2NO5S2 and a molecular weight of 451.47 g/mol. Its IUPAC name is (5Z)-3-(1,3-benzodioxol-5-yl)-5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(1,3-benzodioxol-5-yl)-5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126358139 |
| Molecular Formula | C20H15F2NO5S2 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | (5Z)-3-(1,3-benzodioxol-5-yl)-5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(c3ccc4c(c3)OCO4)C2=O)ccc1OC(F)F |
| InChI | InChI=1S/C20H15F2NO5S2/c1-2-25-15-7-11(3-5-14(15)28-19(21)22)8-17-18(24)23(20(29)30-17)12-4-6-13-16(9-12)27-10-26-13/h3-9,19H,2,10H2,1H3/b17-8- |
| InChIKey | WFCQXJKWCGDAMD-IUXPMGMMSA-N |
| XLogP | 4.82 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|