C22H20BrN3O2 — CID 126338697
6-bromo-2-[(2S)-butan-2-yl]-3-[(4-prop-2-ynoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126338697) has the molecular formula C22H20BrN3O2 and a molecular weight of 438.33 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[(4-prop-2-ynoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(4-prop-2-ynoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126338697 |
| Molecular Formula | C22H20BrN3O2 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(4-prop-2-ynoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | C#CCOc1ccc(C=Nn2c([C@@H](C)CC)nc3ccc(Br)cc3c2=O)cc1 |
| InChI | InChI=1S/C22H20BrN3O2/c1-4-12-28-18-9-6-16(7-10-18)14-24-26-21(15(3)5-2)25-20-11-8-17(23)13-19(20)22(26)27/h1,6-11,13-15H,5,12H2,2-3H3/t15-/m0/s1 |
| InChIKey | HFYBXFRCRRGANG-HNNXBMFYSA-N |
| XLogP | 4.57 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|