C21H18BrIN4O2 — CID 126338882
2-[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-iodophenoxy]acetonitrile (PubChem CID 126338882) has the molecular formula C21H18BrIN4O2 and a molecular weight of 565.21 g/mol. Its IUPAC name is 2-[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-iodophenoxy]acetonitrile.
| Compound Name | 2-[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-iodophenoxy]acetonitrile |
|---|---|
| PubChem CID | 126338882 |
| Molecular Formula | C21H18BrIN4O2 |
| Molecular Weight | 565.21 g/mol |
| Exact Mass | 563.97 |
| IUPAC Name | 2-[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-iodophenoxy]acetonitrile |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCC#N)c(I)c1 |
| InChI | InChI=1S/C21H18BrIN4O2/c1-3-13(2)20-26-18-6-5-15(22)11-16(18)21(28)27(20)25-12-14-4-7-19(17(23)10-14)29-9-8-24/h4-7,10-13H,3,9H2,1-2H3/t13-/m1/s1 |
| InChIKey | LVIQALWLZWHJSB-CYBMUJFWSA-N |
| XLogP | 5.06 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.21 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|