C27H24IN3O5S2 — CID 126339432
(5E)-3-[4-(dimethylamino)phenyl]-5-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126339432) has the molecular formula C27H24IN3O5S2 and a molecular weight of 661.54 g/mol. Its IUPAC name is (5E)-3-[4-(dimethylamino)phenyl]-5-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[4-(dimethylamino)phenyl]-5-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126339432 |
| Molecular Formula | C27H24IN3O5S2 |
| Molecular Weight | 661.54 g/mol |
| Exact Mass | 661.02 |
| IUPAC Name | (5E)-3-[4-(dimethylamino)phenyl]-5-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(c3ccc(N(C)C)cc3)C2=O)cc(I)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H24IN3O5S2/c1-4-35-23-14-18(13-22(28)25(23)36-16-17-5-7-21(8-6-17)31(33)34)15-24-26(32)30(27(37)38-24)20-11-9-19(10-12-20)29(2)3/h5-15H,4,16H2,1-3H3/b24-15+ |
| InChIKey | RRTQSAUZVPURGL-BUVRLJJBSA-N |
| XLogP | 6.65 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.54 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|